C10H23N3 — CID 89122186
(Z)-4-N-ethyl-1-N,4-N-dimethylhex-4-ene-1,4,5-triamine (PubChem CID 89122186) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is (Z)-4-N-ethyl-1-N,4-N-dimethylhex-4-ene-1,4,5-triamine.
| Compound Name | (Z)-4-N-ethyl-1-N,4-N-dimethylhex-4-ene-1,4,5-triamine |
|---|---|
| PubChem CID | 89122186 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | (Z)-4-N-ethyl-1-N,4-N-dimethylhex-4-ene-1,4,5-triamine |
| SMILES | CCN(C)/C(CCCNC)=C(/C)N |
| InChI | InChI=1S/C10H23N3/c1-5-13(4)10(9(2)11)7-6-8-12-3/h12H,5-8,11H2,1-4H3/b10-9- |
| InChIKey | JDPCFVDIQLZEOV-KTKRTIGZSA-N |
| XLogP | 1.13 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|