C17H18Cl6N4 — CID 89122539
4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-di(propan-2-yl)aniline (PubChem CID 89122539) has the molecular formula C17H18Cl6N4 and a molecular weight of 491.08 g/mol. Its IUPAC name is 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-di(propan-2-yl)aniline.
| Compound Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 89122539 |
| Molecular Formula | C17H18Cl6N4 |
| Molecular Weight | 491.08 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-di(propan-2-yl)aniline |
| SMILES | CC(C)N(c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1)C(C)C |
| InChI | InChI=1S/C17H18Cl6N4/c1-9(2)27(10(3)4)12-7-5-11(6-8-12)13-24-14(16(18,19)20)26-15(25-13)17(21,22)23/h5-10H,1-4H3 |
| InChIKey | LMKUABRQVUBBJT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.08 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|