C29H52O8 — CID 89122552
dimethyl (2E,11E)-2-ethylidene-5,8-bis(ethylperoxymethyl)-4,4,9,9-tetramethyl-11-propylidenedodecanedioate (PubChem CID 89122552) has the molecular formula C29H52O8 and a molecular weight of 528.73 g/mol. Its IUPAC name is dimethyl (2E,11E)-2-ethylidene-5,8-bis(ethylperoxymethyl)-4,4,9,9-tetramethyl-11-propylidenedodecanedioate.
| Compound Name | dimethyl (2E,11E)-2-ethylidene-5,8-bis(ethylperoxymethyl)-4,4,9,9-tetramethyl-11-propylidenedodecanedioate |
|---|---|
| PubChem CID | 89122552 |
| Molecular Formula | C29H52O8 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | dimethyl (2E,11E)-2-ethylidene-5,8-bis(ethylperoxymethyl)-4,4,9,9-tetramethyl-11-propylidenedodecanedioate |
| SMILES | C/C=C(\CC(C)(C)C(CCC(COOCC)C(C)(C)C/C(=C\CC)C(=O)OC)COOCC)C(=O)OC |
| InChI | InChI=1S/C29H52O8/c1-11-15-23(27(31)33-10)19-29(7,8)25(21-37-35-14-4)17-16-24(20-36-34-13-3)28(5,6)18-22(12-2)26(30)32-9/h12,15,24-25H,11,13-14,16-21H2,1-10H3/b22-12+,23-15+ |
| InChIKey | VOXRFMZSKLUWBS-BXBSGWAFSA-N |
| XLogP | 6.40 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|