C18H19N3O5 — CID 89122608
2-[5-(2,3-dihydrofuran-2-ylmethylamino)-1,3-dioxoisoindol-2-yl]-5-oxopentanamide (PubChem CID 89122608) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[5-(2,3-dihydrofuran-2-ylmethylamino)-1,3-dioxoisoindol-2-yl]-5-oxopentanamide.
| Compound Name | 2-[5-(2,3-dihydrofuran-2-ylmethylamino)-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 89122608 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[5-(2,3-dihydrofuran-2-ylmethylamino)-1,3-dioxoisoindol-2-yl]-5-oxopentanamide |
| SMILES | NC(=O)C(CCC=O)N1C(=O)c2ccc(NCC3CC=CO3)cc2C1=O |
| InChI | InChI=1S/C18H19N3O5/c19-16(23)15(4-1-7-22)21-17(24)13-6-5-11(9-14(13)18(21)25)20-10-12-3-2-8-26-12/h2,5-9,12,15,20H,1,3-4,10H2,(H2,19,23) |
| InChIKey | DNOASSNOUDALIR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|