About (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene
(3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene (PubChem CID 89122688) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene.
Molecular Properties
| Compound Name | (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene |
| PubChem CID | 89122688 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene |
| SMILES | C/C=C1/C=CC2(CCNCC2)/C1=C/C |
| InChI | InChI=1S/C13H19N/c1-3-11-5-6-13(12(11)4-2)7-9-14-10-8-13/h3-6,14H,7-10H2,1-2H3/b11-3-,12-4+ |
| InChIKey | LHCKWMXCABXWKQ-XPWJWFAVSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene?
The IUPAC name of (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene (CID 89122688) is (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene.
What is the SMILES notation for (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene?
The canonical SMILES for (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene is C/C=C1/C=CC2(CCNCC2)/C1=C/C.
What is the InChIKey of (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene?
The InChIKey is LHCKWMXCABXWKQ-XPWJWFAVSA-N. The full InChI is InChI=1S/C13H19N/c1-3-11-5-6-13(12(11)4-2)7-9-14-10-8-13/h3-6,14H,7-10H2,1-2H3/b11-3-,12-4+.
What are the key properties of (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene?
(3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene has a molecular weight of 189.30 g/mol, XLogP of 2.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,4Z)-3,4-di(ethylidene)-8-azaspiro[4.5]dec-1-ene is sourced from PubChem (CID 89122688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).