C43H52N2O10 — CID 89122980
2-[4-[8-[2,6-dimethoxy-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]-3-methoxyphenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 89122980) has the molecular formula C43H52N2O10 and a molecular weight of 756.89 g/mol. Its IUPAC name is 2-[4-[8-[2,6-dimethoxy-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]-3-methoxyphenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[8-[2,6-dimethoxy-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]-3-methoxyphenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 89122980 |
| Molecular Formula | C43H52N2O10 |
| Molecular Weight | 756.89 g/mol |
| Exact Mass | 756.36 |
| IUPAC Name | 2-[4-[8-[2,6-dimethoxy-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]-3-methoxyphenyl]-6-methoxy-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)NC(c1ccc(OCCCCCCCCOc3c(OC)cc(C=Cc4cc(OC)c(OC)c(OC)c4)cc3OC)c(OC)c1)N2 |
| InChI | InChI=1S/C43H52N2O10/c1-47-31-17-18-33-32(27-31)43(46)45-42(44-33)30-16-19-34(35(26-30)48-2)54-20-12-10-8-9-11-13-21-55-41-38(51-5)24-29(25-39(41)52-6)15-14-28-22-36(49-3)40(53-7)37(23-28)50-4/h14-19,22-27,42,44H,8-13,20-21H2,1-7H3,(H,45,46) |
| InChIKey | JLSFVVBHIRDDKQ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.89 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|