C39H43N3O9 — CID 89122989
2-[3-methoxy-4-[4-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]butoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 89122989) has the molecular formula C39H43N3O9 and a molecular weight of 699.78 g/mol. Its IUPAC name is 2-[3-methoxy-4-[4-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]butoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[3-methoxy-4-[4-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]butoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 89122989 |
| Molecular Formula | C39H43N3O9 |
| Molecular Weight | 699.78 g/mol |
| Exact Mass | 699.30 |
| IUPAC Name | 2-[3-methoxy-4-[4-[2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenoxy]butoxy]phenyl]-6-methyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc([14CH]2NC(=O)c3cc(C)ccc3N2)ccc1OCCCCOc1cc(C2CC(c3cc(OC)c(OC)c(OC)c3)=NO2)ccc1OC |
| InChI | InChI=1S/C39H43N3O9/c1-23-9-12-28-27(17-23)39(43)41-38(40-28)25-11-14-31(33(19-25)45-3)49-15-7-8-16-50-34-18-24(10-13-30(34)44-2)32-22-29(42-51-32)26-20-35(46-4)37(48-6)36(21-26)47-5/h9-14,17-21,32,38,40H,7-8,15-16,22H2,1-6H3,(H,41,43)/i38+2 |
| InChIKey | HMRQLMXCLSJLTF-GEISPHRYSA-N |
| XLogP | 7.00 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.78 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|