C41H40ClFN4O4 — CID 89123240
(E)-3-[3-chloro-4-[[5-[(4-fluorophenyl)methoxy]-2-pyridinyl]oxy]phenyl]-1-[4-[[4-[2-(4-methoxyanilino)ethyl]phenyl]methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 89123240) has the molecular formula C41H40ClFN4O4 and a molecular weight of 707.25 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[[5-[(4-fluorophenyl)methoxy]-2-pyridinyl]oxy]phenyl]-1-[4-[[4-[2-(4-methoxyanilino)ethyl]phenyl]methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[3-chloro-4-[[5-[(4-fluorophenyl)methoxy]-2-pyridinyl]oxy]phenyl]-1-[4-[[4-[2-(4-methoxyanilino)ethyl]phenyl]methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 89123240 |
| Molecular Formula | C41H40ClFN4O4 |
| Molecular Weight | 707.25 g/mol |
| Exact Mass | 706.27 |
| IUPAC Name | (E)-3-[3-chloro-4-[[5-[(4-fluorophenyl)methoxy]-2-pyridinyl]oxy]phenyl]-1-[4-[[4-[2-(4-methoxyanilino)ethyl]phenyl]methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(NCCc2ccc(CN3CCN(C(=O)/C=C/c4ccc(Oc5ccc(OCc6ccc(F)cc6)cn5)c(Cl)c4)CC3)cc2)cc1 |
| InChI | InChI=1S/C41H40ClFN4O4/c1-49-36-14-12-35(13-15-36)44-21-20-30-2-4-32(5-3-30)28-46-22-24-47(25-23-46)41(48)19-9-31-8-17-39(38(42)26-31)51-40-18-16-37(27-45-40)50-29-33-6-10-34(43)11-7-33/h2-19,26-27,44H,20-25,28-29H2,1H3/b19-9+ |
| InChIKey | BPNKGHKJSKCLOR-DJKKODMXSA-N |
| XLogP | 8.27 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.25 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|