About 6-hydroxy-2,2,6-trimethylundecanenitrile
6-hydroxy-2,2,6-trimethylundecanenitrile (PubChem CID 89123985) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 6-hydroxy-2,2,6-trimethylundecanenitrile.
Molecular Properties
| Compound Name | 6-hydroxy-2,2,6-trimethylundecanenitrile |
| PubChem CID | 89123985 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 6-hydroxy-2,2,6-trimethylundecanenitrile |
| SMILES | CCCCCC(C)(O)CCCC(C)(C)C#N |
| InChI | InChI=1S/C14H27NO/c1-5-6-7-10-14(4,16)11-8-9-13(2,3)12-15/h16H,5-11H2,1-4H3 |
| InChIKey | MELBDDWSCOBGCA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-2,2,6-trimethylundecanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,2,6-trimethylundecanenitrile?
The IUPAC name of 6-hydroxy-2,2,6-trimethylundecanenitrile (CID 89123985) is 6-hydroxy-2,2,6-trimethylundecanenitrile.
What is the SMILES notation for 6-hydroxy-2,2,6-trimethylundecanenitrile?
The canonical SMILES for 6-hydroxy-2,2,6-trimethylundecanenitrile is CCCCCC(C)(O)CCCC(C)(C)C#N.
What is the InChIKey of 6-hydroxy-2,2,6-trimethylundecanenitrile?
The InChIKey is MELBDDWSCOBGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-5-6-7-10-14(4,16)11-8-9-13(2,3)12-15/h16H,5-11H2,1-4H3.
What are the key properties of 6-hydroxy-2,2,6-trimethylundecanenitrile?
6-hydroxy-2,2,6-trimethylundecanenitrile has a molecular weight of 225.38 g/mol, XLogP of 4.04, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,2,6-trimethylundecanenitrile is sourced from PubChem (CID 89123985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).