About 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde
2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde (PubChem CID 89124194) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde |
| PubChem CID | 89124194 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde |
| SMILES | CC(C)(O)c1cc(C(C)(C)O)c(CC=O)c(C(C)(C)O)c1 |
| InChI | InChI=1S/C17H26O4/c1-15(2,19)11-9-13(16(3,4)20)12(7-8-18)14(10-11)17(5,6)21/h8-10,19-21H,7H2,1-6H3 |
| InChIKey | UOFGJGIFLUCWIS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde?
The IUPAC name of 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde (CID 89124194) is 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde.
What is the SMILES notation for 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde?
The canonical SMILES for 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde is CC(C)(O)c1cc(C(C)(C)O)c(CC=O)c(C(C)(C)O)c1.
What is the InChIKey of 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde?
The InChIKey is UOFGJGIFLUCWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4/c1-15(2,19)11-9-13(16(3,4)20)12(7-8-18)14(10-11)17(5,6)21/h8-10,19-21H,7H2,1-6H3.
What are the key properties of 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde?
2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde has a molecular weight of 294.39 g/mol, XLogP of 2.11, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4,6-tris(2-hydroxypropan-2-yl)phenyl]acetaldehyde is sourced from PubChem (CID 89124194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).