About 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid
2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid (PubChem CID 89124256) has the molecular formula C5H9F3N2O4S
and a molecular weight of 250.20 g/mol. Its IUPAC name is 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid |
| PubChem CID | 89124256 |
| Molecular Formula | C5H9F3N2O4S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid |
| SMILES | NC(CS(=O)(=O)NCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C5H9F3N2O4S/c6-5(7,8)2-10-15(13,14)1-3(9)4(11)12/h3,10H,1-2,9H2,(H,11,12) |
| InChIKey | DZZLMOUELFWGLV-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid?
The IUPAC name of 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid (CID 89124256) is 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid.
What is the SMILES notation for 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid?
The canonical SMILES for 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid is NC(CS(=O)(=O)NCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid?
The InChIKey is DZZLMOUELFWGLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F3N2O4S/c6-5(7,8)2-10-15(13,14)1-3(9)4(11)12/h3,10H,1-2,9H2,(H,11,12).
What are the key properties of 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid?
2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid has a molecular weight of 250.20 g/mol, XLogP of -1.12, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,2,2-trifluoroethylsulfamoyl)propanoic acid is sourced from PubChem (CID 89124256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).