C25H29N3O5 — CID 89124949
3-[7-[1-[[aminooxy-(3,4-diethoxyphenyl)methylidene]amino]ethenyl]-1-methylindol-3-yl]propanoic acid (PubChem CID 89124949) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 3-[7-[1-[[aminooxy-(3,4-diethoxyphenyl)methylidene]amino]ethenyl]-1-methylindol-3-yl]propanoic acid.
| Compound Name | 3-[7-[1-[[aminooxy-(3,4-diethoxyphenyl)methylidene]amino]ethenyl]-1-methylindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 89124949 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-[7-[1-[[aminooxy-(3,4-diethoxyphenyl)methylidene]amino]ethenyl]-1-methylindol-3-yl]propanoic acid |
| SMILES | C=C(/N=C(\ON)c1ccc(OCC)c(OCC)c1)c1cccc2c(CCC(=O)O)cn(C)c12 |
| InChI | InChI=1S/C25H29N3O5/c1-5-31-21-12-10-17(14-22(21)32-6-2)25(33-26)27-16(3)19-8-7-9-20-18(11-13-23(29)30)15-28(4)24(19)20/h7-10,12,14-15H,3,5-6,11,13,26H2,1-2,4H3,(H,29,30)/b27-25- |
| InChIKey | RMUITUZAMSMTGG-RFBIWTDZSA-N |
| XLogP | 4.30 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|