About 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine
4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine (PubChem CID 89125148) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine.
Molecular Properties
| Compound Name | 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine |
| PubChem CID | 89125148 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine |
| SMILES | C=C/C(=C\C=C/C)CC1CCNCC1 |
| InChI | InChI=1S/C13H21N/c1-3-5-6-12(4-2)11-13-7-9-14-10-8-13/h3-6,13-14H,2,7-11H2,1H3/b5-3-,12-6+ |
| InChIKey | ATFSHEURNUOUMI-YXMBOXQASA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine?
The IUPAC name of 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine (CID 89125148) is 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine.
What is the SMILES notation for 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine?
The canonical SMILES for 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine is C=C/C(=C\C=C/C)CC1CCNCC1.
What is the InChIKey of 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine?
The InChIKey is ATFSHEURNUOUMI-YXMBOXQASA-N. The full InChI is InChI=1S/C13H21N/c1-3-5-6-12(4-2)11-13-7-9-14-10-8-13/h3-6,13-14H,2,7-11H2,1H3/b5-3-,12-6+.
What are the key properties of 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine?
4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine has a molecular weight of 191.32 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidine is sourced from PubChem (CID 89125148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).