About N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide
N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide (PubChem CID 89125229) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide |
| PubChem CID | 89125229 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide |
| SMILES | C/C=C/[C@@H](OC)[C@H](CO)NC(C)=O |
| InChI | InChI=1S/C9H17NO3/c1-4-5-9(13-3)8(6-11)10-7(2)12/h4-5,8-9,11H,6H2,1-3H3,(H,10,12)/b5-4+/t8-,9+/m0/s1 |
| InChIKey | WZDWDSRETFSCGZ-HYNBTVFTSA-N |
| XLogP | 0.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide?
The IUPAC name of N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide (CID 89125229) is N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide.
What is the SMILES notation for N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide?
The canonical SMILES for N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide is C/C=C/[C@@H](OC)[C@H](CO)NC(C)=O.
What is the InChIKey of N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide?
The InChIKey is WZDWDSRETFSCGZ-HYNBTVFTSA-N. The full InChI is InChI=1S/C9H17NO3/c1-4-5-9(13-3)8(6-11)10-7(2)12/h4-5,8-9,11H,6H2,1-3H3,(H,10,12)/b5-4+/t8-,9+/m0/s1.
What are the key properties of N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide?
N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide has a molecular weight of 187.24 g/mol, XLogP of 0.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E,2S,3R)-1-hydroxy-3-methoxyhex-4-en-2-yl]acetamide is sourced from PubChem (CID 89125229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).