C23H35F3N6O — CID 89125316
[1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[4-[(2,4-difluoropent-4-enylamino)methylamino]piperidin-1-yl]methanone (PubChem CID 89125316) has the molecular formula C23H35F3N6O and a molecular weight of 468.57 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[4-[(2,4-difluoropent-4-enylamino)methylamino]piperidin-1-yl]methanone.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[4-[(2,4-difluoropent-4-enylamino)methylamino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 89125316 |
| Molecular Formula | C23H35F3N6O |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[4-[(2,4-difluoropent-4-enylamino)methylamino]piperidin-1-yl]methanone |
| SMILES | C=C(F)CC(F)CNCNC1CCN(C(=O)C2(F)CCN(Cc3ccnc(N)c3)CC2)CC1 |
| InChI | InChI=1S/C23H35F3N6O/c1-17(24)12-19(25)14-28-16-30-20-3-8-32(9-4-20)22(33)23(26)5-10-31(11-6-23)15-18-2-7-29-21(27)13-18/h2,7,13,19-20,28,30H,1,3-6,8-12,14-16H2,(H2,27,29) |
| InChIKey | CGQNSVGTVCXZDV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|