C24H12Br2O3 — CID 89125651
3,12-dibromo-5,7-dimethyl-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-15,17-dione (PubChem CID 89125651) has the molecular formula C24H12Br2O3 and a molecular weight of 508.17 g/mol. Its IUPAC name is 3,12-dibromo-5,7-dimethyl-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-15,17-dione.
| Compound Name | 3,12-dibromo-5,7-dimethyl-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-15,17-dione |
|---|---|
| PubChem CID | 89125651 |
| Molecular Formula | C24H12Br2O3 |
| Molecular Weight | 508.17 g/mol |
| Exact Mass | 505.92 |
| IUPAC Name | 3,12-dibromo-5,7-dimethyl-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaene-15,17-dione |
| SMILES | Cc1ccc2c3c(Br)cc4c5c(ccc(c6c(Br)cc(C)c1c26)c53)C(=O)OC4=O |
| InChI | InChI=1S/C24H12Br2O3/c1-9-3-4-11-20-16(26)8-14-18-13(23(27)29-24(14)28)6-5-12(22(18)20)19-15(25)7-10(2)17(9)21(11)19/h3-8H,1-2H3 |
| InChIKey | DOBRGKMSWCEUKA-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.17 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|