C23H27NO — CID 89125752
1-[(3E,5Z,7Z,9Z)-3-methoxydodeca-1,3,5,7,9,11-hexaen-2-yl]-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 89125752) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-[(3E,5Z,7Z,9Z)-3-methoxydodeca-1,3,5,7,9,11-hexaen-2-yl]-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-[(3E,5Z,7Z,9Z)-3-methoxydodeca-1,3,5,7,9,11-hexaen-2-yl]-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 89125752 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 1-[(3E,5Z,7Z,9Z)-3-methoxydodeca-1,3,5,7,9,11-hexaen-2-yl]-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C=C/C=C\C=C/C=C\C=C(\OC)C(=C)C1c2ccccc2CCN1C |
| InChI | InChI=1S/C23H27NO/c1-5-6-7-8-9-10-11-16-22(25-4)19(2)23-21-15-13-12-14-20(21)17-18-24(23)3/h5-16,23H,1-2,17-18H2,3-4H3/b7-6-,9-8-,11-10-,22-16+ |
| InChIKey | JVUUXASVDUBWII-TVGSYHPFSA-N |
| XLogP | 5.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|