About 3,5-dimethylcyclohexa-1,3-dien-1-amine
3,5-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 89125905) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is 3,5-dimethylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 3,5-dimethylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 89125905 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 3,5-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1=CC(C)CC(N)=C1 |
| InChI | InChI=1S/C8H13N/c1-6-3-7(2)5-8(9)4-6/h3-4,7H,5,9H2,1-2H3 |
| InChIKey | WWHGNPMXWHYMGG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 3,5-dimethylcyclohexa-1,3-dien-1-amine (CID 89125905) is 3,5-dimethylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 3,5-dimethylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 3,5-dimethylcyclohexa-1,3-dien-1-amine is CC1=CC(C)CC(N)=C1.
What is the InChIKey of 3,5-dimethylcyclohexa-1,3-dien-1-amine?
The InChIKey is WWHGNPMXWHYMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-6-3-7(2)5-8(9)4-6/h3-4,7H,5,9H2,1-2H3.
What are the key properties of 3,5-dimethylcyclohexa-1,3-dien-1-amine?
3,5-dimethylcyclohexa-1,3-dien-1-amine has a molecular weight of 123.20 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 89125905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).