C22H22F2N6O — CID 89126364
N,2-diamino-N-(2,3-difluorophenyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-N'-(methylideneamino)pyridine-3-carboximidamide (PubChem CID 89126364) has the molecular formula C22H22F2N6O and a molecular weight of 424.46 g/mol. Its IUPAC name is N,2-diamino-N-(2,3-difluorophenyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-N'-(methylideneamino)pyridine-3-carboximidamide.
| Compound Name | N,2-diamino-N-(2,3-difluorophenyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-N'-(methylideneamino)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 89126364 |
| Molecular Formula | C22H22F2N6O |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N,2-diamino-N-(2,3-difluorophenyl)-5-[4-(2-hydroxypropan-2-yl)phenyl]-N'-(methylideneamino)pyridine-3-carboximidamide |
| SMILES | C=N/N=C(/c1cc(-c2ccc(C(C)(C)O)cc2)cnc1N)N(N)c1cccc(F)c1F |
| InChI | InChI=1S/C22H22F2N6O/c1-22(2,31)15-9-7-13(8-10-15)14-11-16(20(25)28-12-14)21(29-27-3)30(26)18-6-4-5-17(23)19(18)24/h4-12,31H,3,26H2,1-2H3,(H2,25,28)/b29-21- |
| InChIKey | AAODFPCSZXFENH-ANYBSYGZSA-N |
| XLogP | 3.58 |
| TPSA | 113.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|