About (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid
(2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid (PubChem CID 89126380) has the molecular formula C15H28N2O3
and a molecular weight of 284.40 g/mol. Its IUPAC name is (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid.
Molecular Properties
| Compound Name | (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid |
| PubChem CID | 89126380 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid |
| SMILES | C=C(N[C@@H](CCC(C)(C)CC)C(=O)O)N1CCOCC1 |
| InChI | InChI=1S/C15H28N2O3/c1-5-15(3,4)7-6-13(14(18)19)16-12(2)17-8-10-20-11-9-17/h13,16H,2,5-11H2,1,3-4H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | JHLMKANJJMZXFO-ZDUSSCGKSA-N |
| XLogP | 2.05 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid?
The IUPAC name of (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid (CID 89126380) is (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid.
What is the SMILES notation for (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid?
The canonical SMILES for (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid is C=C(N[C@@H](CCC(C)(C)CC)C(=O)O)N1CCOCC1.
What is the InChIKey of (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid?
The InChIKey is JHLMKANJJMZXFO-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H28N2O3/c1-5-15(3,4)7-6-13(14(18)19)16-12(2)17-8-10-20-11-9-17/h13,16H,2,5-11H2,1,3-4H3,(H,18,19)/t13-/m0/s1.
What are the key properties of (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid?
(2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid has a molecular weight of 284.40 g/mol, XLogP of 2.05, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5,5-dimethyl-2-(1-morpholin-4-ylethenylamino)heptanoic acid is sourced from PubChem (CID 89126380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).