C16H28N2 — CID 89126403
1-[(2E,4E,6Z)-5-tert-butylocta-2,4,6-trien-2-yl]piperazine (PubChem CID 89126403) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-[(2E,4E,6Z)-5-tert-butylocta-2,4,6-trien-2-yl]piperazine.
| Compound Name | 1-[(2E,4E,6Z)-5-tert-butylocta-2,4,6-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 89126403 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-[(2E,4E,6Z)-5-tert-butylocta-2,4,6-trien-2-yl]piperazine |
| SMILES | C/C=C\C(=C/C=C(\C)N1CCNCC1)C(C)(C)C |
| InChI | InChI=1S/C16H28N2/c1-6-7-15(16(3,4)5)9-8-14(2)18-12-10-17-11-13-18/h6-9,17H,10-13H2,1-5H3/b7-6-,14-8+,15-9+ |
| InChIKey | SPHBRZDISFUHFP-YOUODTBTSA-N |
| XLogP | 3.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|