C19H34N2O — CID 89126411
1-[4-[(3E,5Z)-4-(aminomethyl)hepta-1,3,5-trien-2-yl]piperidin-1-yl]-3,3-dimethylbutan-1-ol (PubChem CID 89126411) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-[4-[(3E,5Z)-4-(aminomethyl)hepta-1,3,5-trien-2-yl]piperidin-1-yl]-3,3-dimethylbutan-1-ol.
| Compound Name | 1-[4-[(3E,5Z)-4-(aminomethyl)hepta-1,3,5-trien-2-yl]piperidin-1-yl]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 89126411 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 1-[4-[(3E,5Z)-4-(aminomethyl)hepta-1,3,5-trien-2-yl]piperidin-1-yl]-3,3-dimethylbutan-1-ol |
| SMILES | C=C(/C=C(\C=C/C)CN)C1CCN(C(O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H34N2O/c1-6-7-16(14-20)12-15(2)17-8-10-21(11-9-17)18(22)13-19(3,4)5/h6-7,12,17-18,22H,2,8-11,13-14,20H2,1,3-5H3/b7-6-,16-12+ |
| InChIKey | LOZKOASGZJQOJL-SFBITKJJSA-N |
| XLogP | 3.47 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|