About 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one
3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one (PubChem CID 89126551) has the molecular formula C6H11NO3S
and a molecular weight of 177.22 g/mol. Its IUPAC name is 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one |
| PubChem CID | 89126551 |
| Molecular Formula | C6H11NO3S |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one |
| SMILES | O=C(CCO)N1CCS(=O)C1 |
| InChI | InChI=1S/C6H11NO3S/c8-3-1-6(9)7-2-4-11(10)5-7/h8H,1-5H2 |
| InChIKey | VOXNSCVJLZWDJH-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one?
The IUPAC name of 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one (CID 89126551) is 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one.
What is the SMILES notation for 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one?
The canonical SMILES for 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one is O=C(CCO)N1CCS(=O)C1.
What is the InChIKey of 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one?
The InChIKey is VOXNSCVJLZWDJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3S/c8-3-1-6(9)7-2-4-11(10)5-7/h8H,1-5H2.
What are the key properties of 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one?
3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one has a molecular weight of 177.22 g/mol, XLogP of -1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)propan-1-one is sourced from PubChem (CID 89126551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).