About [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine
[(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine (PubChem CID 89126680) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine |
| PubChem CID | 89126680 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine |
| SMILES | C/C1=C(\CN)CC/C=C\CC1 |
| InChI | InChI=1S/C10H17N/c1-9-6-4-2-3-5-7-10(9)8-11/h2-3H,4-8,11H2,1H3/b3-2-,10-9+ |
| InChIKey | SNJRJHHKKADTGH-TWCXWQTESA-N |
| XLogP | 2.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine?
The IUPAC name of [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine (CID 89126680) is [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine.
What is the SMILES notation for [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine?
The canonical SMILES for [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine is C/C1=C(\CN)CC/C=C\CC1.
What is the InChIKey of [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine?
The InChIKey is SNJRJHHKKADTGH-TWCXWQTESA-N. The full InChI is InChI=1S/C10H17N/c1-9-6-4-2-3-5-7-10(9)8-11/h2-3H,4-8,11H2,1H3/b3-2-,10-9+.
What are the key properties of [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine?
[(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine has a molecular weight of 151.25 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z,5Z)-2-methylcycloocta-1,5-dien-1-yl]methanamine is sourced from PubChem (CID 89126680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).