C34H56N2 — CID 89126718
2-[(4-ethylcyclohexa-1,3-dien-1-yl)methyl]-N-[[(1E,3Z)-6-methylcycloocta-1,3-dien-1-yl]methyl]-N'-(2-prop-1-en-2-ylhex-5-enyl)hexane-1,6-diamine (PubChem CID 89126718) has the molecular formula C34H56N2 and a molecular weight of 492.84 g/mol. Its IUPAC name is 2-[(4-ethylcyclohexa-1,3-dien-1-yl)methyl]-N-[[(1E,3Z)-6-methylcycloocta-1,3-dien-1-yl]methyl]-N'-(2-prop-1-en-2-ylhex-5-enyl)hexane-1,6-diamine.
| Compound Name | 2-[(4-ethylcyclohexa-1,3-dien-1-yl)methyl]-N-[[(1E,3Z)-6-methylcycloocta-1,3-dien-1-yl]methyl]-N'-(2-prop-1-en-2-ylhex-5-enyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 89126718 |
| Molecular Formula | C34H56N2 |
| Molecular Weight | 492.84 g/mol |
| Exact Mass | 492.44 |
| IUPAC Name | 2-[(4-ethylcyclohexa-1,3-dien-1-yl)methyl]-N-[[(1E,3Z)-6-methylcycloocta-1,3-dien-1-yl]methyl]-N'-(2-prop-1-en-2-ylhex-5-enyl)hexane-1,6-diamine |
| SMILES | C=CCCC(CNCCCCC(CNC/C1=C/C=C\CC(C)CC1)CC1=CC=C(CC)CC1)C(=C)C |
| InChI | InChI=1S/C34H56N2/c1-6-8-16-34(28(3)4)27-35-23-12-11-15-33(24-31-21-19-30(7-2)20-22-31)26-36-25-32-14-10-9-13-29(5)17-18-32/h6,9-10,14,19,21,29,33-36H,1,3,7-8,11-13,15-18,20,22-27H2,2,4-5H3/b10-9-,32-14+ |
| InChIKey | UBHHQJRWMWLODD-WXYCLTOKSA-N |
| XLogP | 8.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.84 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|