C27H46O10 — CID 89126798
(3R,4S,5R,6S,7S,11R,12S,13R,14R)-14-ethyl-6,12-dihydroxy-3,5,7,11,13-pentamethyl-9-methylidene-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-oxacyclotetradecane-2,10-dione (PubChem CID 89126798) has the molecular formula C27H46O10 and a molecular weight of 530.66 g/mol. Its IUPAC name is (3R,4S,5R,6S,7S,11R,12S,13R,14R)-14-ethyl-6,12-dihydroxy-3,5,7,11,13-pentamethyl-9-methylidene-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5R,6S,7S,11R,12S,13R,14R)-14-ethyl-6,12-dihydroxy-3,5,7,11,13-pentamethyl-9-methylidene-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 89126798 |
| Molecular Formula | C27H46O10 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (3R,4S,5R,6S,7S,11R,12S,13R,14R)-14-ethyl-6,12-dihydroxy-3,5,7,11,13-pentamethyl-9-methylidene-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-oxacyclotetradecane-2,10-dione |
| SMILES | C=C1C[C@H](C)[C@H](O)[C@@H](C)[C@H](OC2OC(C)C(O)C(O)C2O)[C@@H](C)C(=O)O[C@H](CC)[C@H](C)[C@H](O)[C@@H](C)C1=O |
| InChI | InChI=1S/C27H46O10/c1-9-18-13(4)21(30)14(5)19(28)11(2)10-12(3)20(29)15(6)25(16(7)26(34)36-18)37-27-24(33)23(32)22(31)17(8)35-27/h12-18,20-25,27,29-33H,2,9-10H2,1,3-8H3/t12-,13-,14-,15+,16+,17?,18+,20-,21-,22?,23?,24?,25-,27?/m0/s1 |
| InChIKey | GBICWTXANIXOET-KEZKHSSNSA-N |
| XLogP | 0.95 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|