C19H27F6NO — CID 89127107
6-phenylmethoxy-N,N-bis(3,3,3-trifluoropropyl)hexan-1-amine (PubChem CID 89127107) has the molecular formula C19H27F6NO and a molecular weight of 399.42 g/mol. Its IUPAC name is 6-phenylmethoxy-N,N-bis(3,3,3-trifluoropropyl)hexan-1-amine.
| Compound Name | 6-phenylmethoxy-N,N-bis(3,3,3-trifluoropropyl)hexan-1-amine |
|---|---|
| PubChem CID | 89127107 |
| Molecular Formula | C19H27F6NO |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 6-phenylmethoxy-N,N-bis(3,3,3-trifluoropropyl)hexan-1-amine |
| SMILES | FC(F)(F)CCN(CCCCCCOCc1ccccc1)CCC(F)(F)F |
| InChI | InChI=1S/C19H27F6NO/c20-18(21,22)10-13-26(14-11-19(23,24)25)12-6-1-2-7-15-27-16-17-8-4-3-5-9-17/h3-5,8-9H,1-2,6-7,10-16H2 |
| InChIKey | VFQYDOJOWGSXAU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|