C22H20BN3O3 — CID 89127171
CID 89127171 (PubChem CID 89127171) has the molecular formula C22H20BN3O3 and a molecular weight of 385.23 g/mol.
| Compound Name | CID 89127171 |
|---|---|
| PubChem CID | 89127171 |
| Molecular Formula | C22H20BN3O3 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | — |
| SMILES | [B]N1CCC(CCc2noc3c(C=O)c(Oc4ccc(C#N)cc4)ccc23)CC1 |
| InChI | InChI=1S/C22H20BN3O3/c23-26-11-9-15(10-12-26)3-7-20-18-6-8-21(19(14-27)22(18)29-25-20)28-17-4-1-16(13-24)2-5-17/h1-2,4-6,8,14-15H,3,7,9-12H2 |
| InChIKey | QEGLZMLYIVWEJS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|