About 6-methylperoxyoxane-2,3,5-triol
6-methylperoxyoxane-2,3,5-triol (PubChem CID 89127286) has the molecular formula C6H12O6
and a molecular weight of 180.16 g/mol. Its IUPAC name is 6-methylperoxyoxane-2,3,5-triol.
Molecular Properties
| Compound Name | 6-methylperoxyoxane-2,3,5-triol |
| PubChem CID | 89127286 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-methylperoxyoxane-2,3,5-triol |
| SMILES | COOC1OC(O)C(O)CC1O |
| InChI | InChI=1S/C6H12O6/c1-10-12-6-4(8)2-3(7)5(9)11-6/h3-9H,2H2,1H3 |
| InChIKey | NNOJKHRTOQFTPA-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-methylperoxyoxane-2,3,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylperoxyoxane-2,3,5-triol?
The IUPAC name of 6-methylperoxyoxane-2,3,5-triol (CID 89127286) is 6-methylperoxyoxane-2,3,5-triol.
What is the SMILES notation for 6-methylperoxyoxane-2,3,5-triol?
The canonical SMILES for 6-methylperoxyoxane-2,3,5-triol is COOC1OC(O)C(O)CC1O.
What is the InChIKey of 6-methylperoxyoxane-2,3,5-triol?
The InChIKey is NNOJKHRTOQFTPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O6/c1-10-12-6-4(8)2-3(7)5(9)11-6/h3-9H,2H2,1H3.
What are the key properties of 6-methylperoxyoxane-2,3,5-triol?
6-methylperoxyoxane-2,3,5-triol has a molecular weight of 180.16 g/mol, XLogP of -1.65, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylperoxyoxane-2,3,5-triol is sourced from PubChem (CID 89127286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).