C20H24F3NO4 — CID 89127514
[6-[2-propyl-4-[1,1,1-trifluoro-2-(methoxymethoxy)propan-2-yl]phenoxy]-2-pyridinyl]methanol (PubChem CID 89127514) has the molecular formula C20H24F3NO4 and a molecular weight of 399.41 g/mol. Its IUPAC name is [6-[2-propyl-4-[1,1,1-trifluoro-2-(methoxymethoxy)propan-2-yl]phenoxy]-2-pyridinyl]methanol.
| Compound Name | [6-[2-propyl-4-[1,1,1-trifluoro-2-(methoxymethoxy)propan-2-yl]phenoxy]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 89127514 |
| Molecular Formula | C20H24F3NO4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [6-[2-propyl-4-[1,1,1-trifluoro-2-(methoxymethoxy)propan-2-yl]phenoxy]-2-pyridinyl]methanol |
| SMILES | CCCc1cc(C(C)(OCOC)C(F)(F)F)ccc1Oc1cccc(CO)n1 |
| InChI | InChI=1S/C20H24F3NO4/c1-4-6-14-11-15(19(2,20(21,22)23)27-13-26-3)9-10-17(14)28-18-8-5-7-16(12-25)24-18/h5,7-11,25H,4,6,12-13H2,1-3H3 |
| InChIKey | HKLKZEUFLSNFGZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|