C12H17F9O2 — CID 89127782
4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2,4-trimethylpentan-1-ol (PubChem CID 89127782) has the molecular formula C12H17F9O2 and a molecular weight of 364.25 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2,4-trimethylpentan-1-ol.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 89127782 |
| Molecular Formula | C12H17F9O2 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2,4-trimethylpentan-1-ol |
| SMILES | CC(C)(CO)CC(C)(C)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17F9O2/c1-7(2,6-22)5-8(3,4)23-9(10(13,14)15,11(16,17)18)12(19,20)21/h22H,5-6H2,1-4H3 |
| InChIKey | FRZYITRQSFXRIR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |