About 3-formyldodec-1-en-4-yl formate
3-formyldodec-1-en-4-yl formate (PubChem CID 89127880) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is 3-formyldodec-1-en-4-yl formate.
Molecular Properties
| Compound Name | 3-formyldodec-1-en-4-yl formate |
| PubChem CID | 89127880 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3-formyldodec-1-en-4-yl formate |
| SMILES | C=CC(C=O)C(CCCCCCCC)OC=O |
| InChI | InChI=1S/C14H24O3/c1-3-5-6-7-8-9-10-14(17-12-16)13(4-2)11-15/h4,11-14H,2-3,5-10H2,1H3 |
| InChIKey | XGNJRZRTKGHIHW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-formyldodec-1-en-4-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formyldodec-1-en-4-yl formate?
The IUPAC name of 3-formyldodec-1-en-4-yl formate (CID 89127880) is 3-formyldodec-1-en-4-yl formate.
What is the SMILES notation for 3-formyldodec-1-en-4-yl formate?
The canonical SMILES for 3-formyldodec-1-en-4-yl formate is C=CC(C=O)C(CCCCCCCC)OC=O.
What is the InChIKey of 3-formyldodec-1-en-4-yl formate?
The InChIKey is XGNJRZRTKGHIHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-3-5-6-7-8-9-10-14(17-12-16)13(4-2)11-15/h4,11-14H,2-3,5-10H2,1H3.
What are the key properties of 3-formyldodec-1-en-4-yl formate?
3-formyldodec-1-en-4-yl formate has a molecular weight of 240.34 g/mol, XLogP of 3.28, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formyldodec-1-en-4-yl formate is sourced from PubChem (CID 89127880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).