C9H9F9O2 — CID 89127896
(Z)-1,1,1,7,7,7-hexafluoro-4-methyl-2-(trifluoromethyl)hept-3-ene-2,6-diol (PubChem CID 89127896) has the molecular formula C9H9F9O2 and a molecular weight of 320.15 g/mol. Its IUPAC name is (Z)-1,1,1,7,7,7-hexafluoro-4-methyl-2-(trifluoromethyl)hept-3-ene-2,6-diol.
| Compound Name | (Z)-1,1,1,7,7,7-hexafluoro-4-methyl-2-(trifluoromethyl)hept-3-ene-2,6-diol |
|---|---|
| PubChem CID | 89127896 |
| Molecular Formula | C9H9F9O2 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (Z)-1,1,1,7,7,7-hexafluoro-4-methyl-2-(trifluoromethyl)hept-3-ene-2,6-diol |
| SMILES | C/C(=C/C(O)(C(F)(F)F)C(F)(F)F)CC(O)C(F)(F)F |
| InChI | InChI=1S/C9H9F9O2/c1-4(2-5(19)7(10,11)12)3-6(20,8(13,14)15)9(16,17)18/h3,5,19-20H,2H2,1H3/b4-3- |
| InChIKey | WLOKTKADUISWCG-ARJAWSKDSA-N |
| XLogP | 3.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|