C32H33N3O2 — CID 89128239
3-[[6-[5-(3,5-dimethyl-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]cyclobutane-1-carbaldehyde (PubChem CID 89128239) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 3-[[6-[5-(3,5-dimethyl-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]cyclobutane-1-carbaldehyde.
| Compound Name | 3-[[6-[5-(3,5-dimethyl-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]cyclobutane-1-carbaldehyde |
|---|---|
| PubChem CID | 89128239 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 3-[[6-[5-(3,5-dimethyl-4-phenylphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-methylamino]cyclobutane-1-carbaldehyde |
| SMILES | Cc1cc(-c2nc(-c3ccc4c(c3)CCCC4N(C)C3CC(C=O)C3)no2)cc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C32H33N3O2/c1-20-14-26(15-21(2)30(20)23-8-5-4-6-9-23)32-33-31(34-37-32)25-12-13-28-24(18-25)10-7-11-29(28)35(3)27-16-22(17-27)19-36/h4-6,8-9,12-15,18-19,22,27,29H,7,10-11,16-17H2,1-3H3 |
| InChIKey | UYGOOLBZPALFGC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|