About (5E)-2-chloro-5-methoxyhepta-1,5-diene
(5E)-2-chloro-5-methoxyhepta-1,5-diene (PubChem CID 89128286) has the molecular formula C8H13ClO
and a molecular weight of 160.64 g/mol. Its IUPAC name is (5E)-2-chloro-5-methoxyhepta-1,5-diene.
Molecular Properties
| Compound Name | (5E)-2-chloro-5-methoxyhepta-1,5-diene |
| PubChem CID | 89128286 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (5E)-2-chloro-5-methoxyhepta-1,5-diene |
| SMILES | C=C(Cl)CC/C(=C\C)OC |
| InChI | InChI=1S/C8H13ClO/c1-4-8(10-3)6-5-7(2)9/h4H,2,5-6H2,1,3H3/b8-4+ |
| InChIKey | VHQYMKSONGQLHV-XBXARRHUSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2-chloro-5-methoxyhepta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2-chloro-5-methoxyhepta-1,5-diene?
The IUPAC name of (5E)-2-chloro-5-methoxyhepta-1,5-diene (CID 89128286) is (5E)-2-chloro-5-methoxyhepta-1,5-diene.
What is the SMILES notation for (5E)-2-chloro-5-methoxyhepta-1,5-diene?
The canonical SMILES for (5E)-2-chloro-5-methoxyhepta-1,5-diene is C=C(Cl)CC/C(=C\C)OC.
What is the InChIKey of (5E)-2-chloro-5-methoxyhepta-1,5-diene?
The InChIKey is VHQYMKSONGQLHV-XBXARRHUSA-N. The full InChI is InChI=1S/C8H13ClO/c1-4-8(10-3)6-5-7(2)9/h4H,2,5-6H2,1,3H3/b8-4+.
What are the key properties of (5E)-2-chloro-5-methoxyhepta-1,5-diene?
(5E)-2-chloro-5-methoxyhepta-1,5-diene has a molecular weight of 160.64 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2-chloro-5-methoxyhepta-1,5-diene is sourced from PubChem (CID 89128286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).