C19H11F10NO3S — CID 89128436
[(Z)-[1-(9H-fluoren-2-yl)-2-fluoroethylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 89128436) has the molecular formula C19H11F10NO3S and a molecular weight of 523.35 g/mol. Its IUPAC name is [(Z)-[1-(9H-fluoren-2-yl)-2-fluoroethylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(Z)-[1-(9H-fluoren-2-yl)-2-fluoroethylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 89128436 |
| Molecular Formula | C19H11F10NO3S |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | [(Z)-[1-(9H-fluoren-2-yl)-2-fluoroethylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(O/N=C(\CF)c1ccc2c(c1)Cc1ccccc1-2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H11F10NO3S/c20-9-15(11-5-6-14-12(8-11)7-10-3-1-2-4-13(10)14)30-33-34(31,32)19(28,29)17(23,24)16(21,22)18(25,26)27/h1-6,8H,7,9H2/b30-15+ |
| InChIKey | RSSQGLUUEUUNKZ-FJEPWZHXSA-N |
| XLogP | 5.70 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|