C40H56S2Si — CID 89128654
bis[3-(4-tert-butylphenyl)-2,5-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl]-dimethylsilane (PubChem CID 89128654) has the molecular formula C40H56S2Si and a molecular weight of 629.11 g/mol. Its IUPAC name is bis[3-(4-tert-butylphenyl)-2,5-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl]-dimethylsilane.
| Compound Name | bis[3-(4-tert-butylphenyl)-2,5-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl]-dimethylsilane |
|---|---|
| PubChem CID | 89128654 |
| Molecular Formula | C40H56S2Si |
| Molecular Weight | 629.11 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | bis[3-(4-tert-butylphenyl)-2,5-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl]-dimethylsilane |
| SMILES | CC1=C(c2ccc(C(C)(C)C)cc2)C2CC(C)C([Si](C)(C)C3C(C)CC4C(c5ccc(C(C)(C)C)cc5)=C(C)SC43)C2S1 |
| InChI | InChI=1S/C40H56S2Si/c1-23-21-31-33(27-13-17-29(18-14-27)39(5,6)7)25(3)41-35(31)37(23)43(11,12)38-24(2)22-32-34(26(4)42-36(32)38)28-15-19-30(20-16-28)40(8,9)10/h13-20,23-24,31-32,35-38H,21-22H2,1-12H3 |
| InChIKey | QUIUQUURBLMYIA-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.11 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|