C36H48S2Si — CID 89128655
bis(2,5-diethyl-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane (PubChem CID 89128655) has the molecular formula C36H48S2Si and a molecular weight of 573.00 g/mol. Its IUPAC name is bis(2,5-diethyl-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane.
| Compound Name | bis(2,5-diethyl-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane |
|---|---|
| PubChem CID | 89128655 |
| Molecular Formula | C36H48S2Si |
| Molecular Weight | 573.00 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | bis(2,5-diethyl-3-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophen-6-yl)-dimethylsilane |
| SMILES | CCC1=C(c2ccccc2)C2CC(CC)C([Si](C)(C)C3C(CC)CC4C(c5ccccc5)=C(CC)SC43)C2S1 |
| InChI | InChI=1S/C36H48S2Si/c1-7-23-21-27-31(25-17-13-11-14-18-25)29(9-3)37-33(27)35(23)39(5,6)36-24(8-2)22-28-32(26-19-15-12-16-20-26)30(10-4)38-34(28)36/h11-20,23-24,27-28,33-36H,7-10,21-22H2,1-6H3 |
| InChIKey | FLIYAUBSVGRDLG-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.00 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|