C24H30F3N — CID 89128670
(2R)-1-[(1R)-1-cyclohex-3-en-1-yl-4-methylpent-4-en-2-ynyl]-2-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]piperidine (PubChem CID 89128670) has the molecular formula C24H30F3N and a molecular weight of 389.51 g/mol. Its IUPAC name is (2R)-1-[(1R)-1-cyclohex-3-en-1-yl-4-methylpent-4-en-2-ynyl]-2-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]piperidine.
| Compound Name | (2R)-1-[(1R)-1-cyclohex-3-en-1-yl-4-methylpent-4-en-2-ynyl]-2-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]piperidine |
|---|---|
| PubChem CID | 89128670 |
| Molecular Formula | C24H30F3N |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | (2R)-1-[(1R)-1-cyclohex-3-en-1-yl-4-methylpent-4-en-2-ynyl]-2-[4-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]piperidine |
| SMILES | C=C(C)C#C[C@@H](C1CC=CCC1)N1CCCC[C@@H]1C1C=CC(C(F)(F)F)=CC1 |
| InChI | InChI=1S/C24H30F3N/c1-18(2)11-16-23(19-8-4-3-5-9-19)28-17-7-6-10-22(28)20-12-14-21(15-13-20)24(25,26)27/h3-4,12,14-15,19-20,22-23H,1,5-10,13,17H2,2H3/t19?,20?,22-,23+/m1/s1 |
| InChIKey | ZTBSTLANTZGKNK-PHFCHIBXSA-N |
| XLogP | 6.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|