C25H32N4O3S — CID 89128704
2-[2-[[5-[[(4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-2,4-dimethyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]methoxy]naphthalen-1-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 89128704) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is 2-[2-[[5-[[(4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-2,4-dimethyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]methoxy]naphthalen-1-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | 2-[2-[[5-[[(4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-2,4-dimethyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]methoxy]naphthalen-1-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 89128704 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-[2-[[5-[[(4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-2,4-dimethyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]methoxy]naphthalen-1-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | CC1=C(COc2cccc3c(CSCCN=C(N)N)cccc23)[C@H](C)[C@@H]2[C@@H]([C@@H](C)O)C(=O)N12 |
| InChI | InChI=1S/C25H32N4O3S/c1-14-20(15(2)29-23(14)22(16(3)30)24(29)31)12-32-21-9-5-7-18-17(6-4-8-19(18)21)13-33-11-10-28-25(26)27/h4-9,14,16,22-23,30H,10-13H2,1-3H3,(H4,26,27,28)/t14-,16+,22+,23+/m0/s1 |
| InChIKey | NHOJPYGCKMHYIK-NCQZJVJLSA-N |
| XLogP | 2.86 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|