C25H37NO3 — CID 89128719
methyl (2R)-2-[2-(1-methylidene-3,5,6,7,8,8a-hexahydro-2H-indolizin-2-yl)ethyl]-3-phenylmethoxyhexanoate (PubChem CID 89128719) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is methyl (2R)-2-[2-(1-methylidene-3,5,6,7,8,8a-hexahydro-2H-indolizin-2-yl)ethyl]-3-phenylmethoxyhexanoate.
| Compound Name | methyl (2R)-2-[2-(1-methylidene-3,5,6,7,8,8a-hexahydro-2H-indolizin-2-yl)ethyl]-3-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 89128719 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | methyl (2R)-2-[2-(1-methylidene-3,5,6,7,8,8a-hexahydro-2H-indolizin-2-yl)ethyl]-3-phenylmethoxyhexanoate |
| SMILES | C=C1C(CC[C@@H](C(=O)OC)C(CCC)OCc2ccccc2)CN2CCCCC12 |
| InChI | InChI=1S/C25H37NO3/c1-4-10-24(29-18-20-11-6-5-7-12-20)22(25(27)28-3)15-14-21-17-26-16-9-8-13-23(26)19(21)2/h5-7,11-12,21-24H,2,4,8-10,13-18H2,1,3H3/t21?,22-,23?,24?/m1/s1 |
| InChIKey | GPXOZHKBQKDCHJ-NJEQKKOJSA-N |
| XLogP | 4.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|