About CID 89128837
CID 89128837 (PubChem CID 89128837) has the molecular formula C31H43BN6O3
and a molecular weight of 558.54 g/mol.
Molecular Properties
| Compound Name | CID 89128837 |
| PubChem CID | 89128837 |
| Molecular Formula | C31H43BN6O3 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | — |
| SMILES | [B]CCCCCCCC(=O)Nc1ccccc1C(=O)NCc1c(CC)nc2c(cnn2CC)c1NC1CCOCC1 |
| InChI | InChI=1S/C31H43BN6O3/c1-3-26-24(29(35-22-15-18-41-19-16-22)25-21-34-38(4-2)30(25)37-26)20-33-31(40)23-12-9-10-13-27(23)36-28(39)14-8-6-5-7-11-17-32/h9-10,12-13,21-22H,3-8,11,14-20H2,1-2H3,(H,33,40)(H,35,37)(H,36,39) |
| InChIKey | QPQGPRXNOALWLL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89128837 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89128837?
The IUPAC name of CID 89128837 (CID 89128837) is not available.
What is the SMILES notation for CID 89128837?
The canonical SMILES for CID 89128837 is [B]CCCCCCCC(=O)Nc1ccccc1C(=O)NCc1c(CC)nc2c(cnn2CC)c1NC1CCOCC1.
What is the InChIKey of CID 89128837?
The InChIKey is QPQGPRXNOALWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H43BN6O3/c1-3-26-24(29(35-22-15-18-41-19-16-22)25-21-34-38(4-2)30(25)37-26)20-33-31(40)23-12-9-10-13-27(23)36-28(39)14-8-6-5-7-11-17-32/h9-10,12-13,21-22H,3-8,11,14-20H2,1-2H3,(H,33,40)(H,35,37)(H,36,39).
What are the key properties of CID 89128837?
CID 89128837 has a molecular weight of 558.54 g/mol, XLogP of 5.40, 15 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89128837 is sourced from PubChem (CID 89128837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).