About 3-prop-1-en-2-yl-3,4-dihydropyridine
3-prop-1-en-2-yl-3,4-dihydropyridine (PubChem CID 89129177) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is 3-prop-1-en-2-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 3-prop-1-en-2-yl-3,4-dihydropyridine |
| PubChem CID | 89129177 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 3-prop-1-en-2-yl-3,4-dihydropyridine |
| SMILES | C=C(C)C1C=NC=CC1 |
| InChI | InChI=1S/C8H11N/c1-7(2)8-4-3-5-9-6-8/h3,5-6,8H,1,4H2,2H3 |
| InChIKey | BXDUYALOIMCEFV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-1-en-2-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-1-en-2-yl-3,4-dihydropyridine?
The IUPAC name of 3-prop-1-en-2-yl-3,4-dihydropyridine (CID 89129177) is 3-prop-1-en-2-yl-3,4-dihydropyridine.
What is the SMILES notation for 3-prop-1-en-2-yl-3,4-dihydropyridine?
The canonical SMILES for 3-prop-1-en-2-yl-3,4-dihydropyridine is C=C(C)C1C=NC=CC1.
What is the InChIKey of 3-prop-1-en-2-yl-3,4-dihydropyridine?
The InChIKey is BXDUYALOIMCEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N/c1-7(2)8-4-3-5-9-6-8/h3,5-6,8H,1,4H2,2H3.
What are the key properties of 3-prop-1-en-2-yl-3,4-dihydropyridine?
3-prop-1-en-2-yl-3,4-dihydropyridine has a molecular weight of 121.18 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-1-en-2-yl-3,4-dihydropyridine is sourced from PubChem (CID 89129177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).