C25H35NO4 — CID 89129304
tert-butyl (2E,3E,5E,9E)-11-[(2R,3S)-2-cyano-3-propan-2-yloxiran-2-yl]-2-ethylidene-4,10-dimethyl-11-oxoundeca-3,5,9-trienoate (PubChem CID 89129304) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is tert-butyl (2E,3E,5E,9E)-11-[(2R,3S)-2-cyano-3-propan-2-yloxiran-2-yl]-2-ethylidene-4,10-dimethyl-11-oxoundeca-3,5,9-trienoate.
| Compound Name | tert-butyl (2E,3E,5E,9E)-11-[(2R,3S)-2-cyano-3-propan-2-yloxiran-2-yl]-2-ethylidene-4,10-dimethyl-11-oxoundeca-3,5,9-trienoate |
|---|---|
| PubChem CID | 89129304 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | tert-butyl (2E,3E,5E,9E)-11-[(2R,3S)-2-cyano-3-propan-2-yloxiran-2-yl]-2-ethylidene-4,10-dimethyl-11-oxoundeca-3,5,9-trienoate |
| SMILES | C/C=C(\C=C(C)\C=C\CC/C=C(\C)C(=O)[C@]1(C#N)O[C@H]1C(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H35NO4/c1-9-20(23(28)30-24(6,7)8)15-18(4)13-11-10-12-14-19(5)21(27)25(16-26)22(29-25)17(2)3/h9,11,13-15,17,22H,10,12H2,1-8H3/b13-11+,18-15+,19-14+,20-9+/t22-,25-/m0/s1 |
| InChIKey | CVRUPFFOYKDHCJ-OOQLWWRLSA-N |
| XLogP | 5.39 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|