About (Z)-2-iminopent-3-ene-1,4-diamine
(Z)-2-iminopent-3-ene-1,4-diamine (PubChem CID 89129435) has the molecular formula C5H11N3
and a molecular weight of 113.16 g/mol. Its IUPAC name is (Z)-2-iminopent-3-ene-1,4-diamine.
Molecular Properties
| Compound Name | (Z)-2-iminopent-3-ene-1,4-diamine |
| PubChem CID | 89129435 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | (Z)-2-iminopent-3-ene-1,4-diamine |
| SMILES | [H]/N=C(/C=C(/C)N)CN |
| InChI | InChI=1S/C5H11N3/c1-4(7)2-5(8)3-6/h2,8H,3,6-7H2,1H3/b4-2-,8-5- |
| InChIKey | VRQGZJYMEAVDEB-CFDRCTBLSA-N |
| XLogP | -0.17 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-iminopent-3-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-iminopent-3-ene-1,4-diamine?
The IUPAC name of (Z)-2-iminopent-3-ene-1,4-diamine (CID 89129435) is (Z)-2-iminopent-3-ene-1,4-diamine.
What is the SMILES notation for (Z)-2-iminopent-3-ene-1,4-diamine?
The canonical SMILES for (Z)-2-iminopent-3-ene-1,4-diamine is [H]/N=C(/C=C(/C)N)CN.
What is the InChIKey of (Z)-2-iminopent-3-ene-1,4-diamine?
The InChIKey is VRQGZJYMEAVDEB-CFDRCTBLSA-N. The full InChI is InChI=1S/C5H11N3/c1-4(7)2-5(8)3-6/h2,8H,3,6-7H2,1H3/b4-2-,8-5-.
What are the key properties of (Z)-2-iminopent-3-ene-1,4-diamine?
(Z)-2-iminopent-3-ene-1,4-diamine has a molecular weight of 113.16 g/mol, XLogP of -0.17, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-iminopent-3-ene-1,4-diamine is sourced from PubChem (CID 89129435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).