C8H14N2 — CID 89129495
(1E,3Z)-1-N',2-dimethylhexa-1,3,5-triene-1,1-diamine (PubChem CID 89129495) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (1E,3Z)-1-N',2-dimethylhexa-1,3,5-triene-1,1-diamine.
| Compound Name | (1E,3Z)-1-N',2-dimethylhexa-1,3,5-triene-1,1-diamine |
|---|---|
| PubChem CID | 89129495 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (1E,3Z)-1-N',2-dimethylhexa-1,3,5-triene-1,1-diamine |
| SMILES | C=C/C=C\C(C)=C(/N)NC |
| InChI | InChI=1S/C8H14N2/c1-4-5-6-7(2)8(9)10-3/h4-6,10H,1,9H2,2-3H3/b6-5-,8-7+ |
| InChIKey | SBQLVIFYFHFOBM-IGTJQSIKSA-N |
| XLogP | 1.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|