C10H11N3 — CID 89129566
(2R)-2-azido-3-methylidene-1,2,6,7-tetrahydroindene (PubChem CID 89129566) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is (2R)-2-azido-3-methylidene-1,2,6,7-tetrahydroindene.
| Compound Name | (2R)-2-azido-3-methylidene-1,2,6,7-tetrahydroindene |
|---|---|
| PubChem CID | 89129566 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (2R)-2-azido-3-methylidene-1,2,6,7-tetrahydroindene |
| SMILES | C=C1C2=C(CCC=C2)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C10H11N3/c1-7-9-5-3-2-4-8(9)6-10(7)12-13-11/h3,5,10H,1-2,4,6H2/t10-/m1/s1 |
| InChIKey | KTYBCORRFHRWLG-SNVBAGLBSA-N |
| XLogP | 3.27 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|