About (3Z,5E)-5-methoxyhepta-3,5-dienal
(3Z,5E)-5-methoxyhepta-3,5-dienal (PubChem CID 89129591) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (3Z,5E)-5-methoxyhepta-3,5-dienal.
Molecular Properties
| Compound Name | (3Z,5E)-5-methoxyhepta-3,5-dienal |
| PubChem CID | 89129591 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (3Z,5E)-5-methoxyhepta-3,5-dienal |
| SMILES | C/C=C(\C=C/CC=O)OC |
| InChI | InChI=1S/C8H12O2/c1-3-8(10-2)6-4-5-7-9/h3-4,6-7H,5H2,1-2H3/b6-4-,8-3+ |
| InChIKey | YNCOOVYQDJQONV-MROOEUIUSA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-5-methoxyhepta-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-5-methoxyhepta-3,5-dienal?
The IUPAC name of (3Z,5E)-5-methoxyhepta-3,5-dienal (CID 89129591) is (3Z,5E)-5-methoxyhepta-3,5-dienal.
What is the SMILES notation for (3Z,5E)-5-methoxyhepta-3,5-dienal?
The canonical SMILES for (3Z,5E)-5-methoxyhepta-3,5-dienal is C/C=C(\C=C/CC=O)OC.
What is the InChIKey of (3Z,5E)-5-methoxyhepta-3,5-dienal?
The InChIKey is YNCOOVYQDJQONV-MROOEUIUSA-N. The full InChI is InChI=1S/C8H12O2/c1-3-8(10-2)6-4-5-7-9/h3-4,6-7H,5H2,1-2H3/b6-4-,8-3+.
What are the key properties of (3Z,5E)-5-methoxyhepta-3,5-dienal?
(3Z,5E)-5-methoxyhepta-3,5-dienal has a molecular weight of 140.18 g/mol, XLogP of 1.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-5-methoxyhepta-3,5-dienal is sourced from PubChem (CID 89129591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).