C28H31Cl2N5O3 — CID 89129601
ethyl N-[(3R)-1-[2-[4-(3-aminophenyl)-N-[(3,5-dichlorophenyl)carbamoyl]anilino]ethyl]pyrrolidin-3-yl]carbamate (PubChem CID 89129601) has the molecular formula C28H31Cl2N5O3 and a molecular weight of 556.49 g/mol. Its IUPAC name is ethyl N-[(3R)-1-[2-[4-(3-aminophenyl)-N-[(3,5-dichlorophenyl)carbamoyl]anilino]ethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | ethyl N-[(3R)-1-[2-[4-(3-aminophenyl)-N-[(3,5-dichlorophenyl)carbamoyl]anilino]ethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 89129601 |
| Molecular Formula | C28H31Cl2N5O3 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | ethyl N-[(3R)-1-[2-[4-(3-aminophenyl)-N-[(3,5-dichlorophenyl)carbamoyl]anilino]ethyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1CCN(CCN(C(=O)Nc2cc(Cl)cc(Cl)c2)c2ccc(-c3cccc(N)c3)cc2)C1 |
| InChI | InChI=1S/C28H31Cl2N5O3/c1-2-38-28(37)33-24-10-11-34(18-24)12-13-35(27(36)32-25-16-21(29)15-22(30)17-25)26-8-6-19(7-9-26)20-4-3-5-23(31)14-20/h3-9,14-17,24H,2,10-13,18,31H2,1H3,(H,32,36)(H,33,37)/t24-/m1/s1 |
| InChIKey | NSGVNRABKCGPFU-XMMPIXPASA-N |
| XLogP | 6.10 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|