About 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide
9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide (PubChem CID 89129720) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide.
Molecular Properties
| Compound Name | 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide |
| PubChem CID | 89129720 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide |
| SMILES | NC(=NO)c1cccc2c1Oc1ccccc1/C2=C1\C[C@H]2CC[C@@H](C1)N2 |
| InChI | InChI=1S/C21H21N3O2/c22-21(24-25)17-6-3-5-16-19(12-10-13-8-9-14(11-12)23-13)15-4-1-2-7-18(15)26-20(16)17/h1-7,13-14,23,25H,8-11H2,(H2,22,24)/b19-12-/t13-,14+/m1/s1 |
| InChIKey | IJFKXPBJTZOWMN-XYCUDVCBSA-N |
| XLogP | 3.60 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide?
The IUPAC name of 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide (CID 89129720) is 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide.
What is the SMILES notation for 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide?
The canonical SMILES for 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide is NC(=NO)c1cccc2c1Oc1ccccc1/C2=C1\C[C@H]2CC[C@@H](C1)N2.
What is the InChIKey of 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide?
The InChIKey is IJFKXPBJTZOWMN-XYCUDVCBSA-N. The full InChI is InChI=1S/C21H21N3O2/c22-21(24-25)17-6-3-5-16-19(12-10-13-8-9-14(11-12)23-13)15-4-1-2-7-18(15)26-20(16)17/h1-7,13-14,23,25H,8-11H2,(H2,22,24)/b19-12-/t13-,14+/m1/s1.
What are the key properties of 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide?
9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide has a molecular weight of 347.42 g/mol, XLogP of 3.60, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-ylidene]-N'-hydroxyxanthene-4-carboximidamide is sourced from PubChem (CID 89129720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).